CAS 909282-26-4 is the registry number for 2-(2-((Tert-butyldimethylsilyl)oxy)ethoxy)acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid (CAS 909282-26-4) is a chemical compound with the molecular formula C10H22O4Si and a molecular weight of 234.36 g/mol. IUPAC name: 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid. InChIKey: GBHFDUWTIMUQCC-UHFFFAOYSA-N.
| Molecular formula | C10H22O4Si |
|---|---|
| Molecular weight | 234.36 g/mol |
| IUPAC name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid |
| InChIKey | GBHFDUWTIMUQCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCC(=O)O |
Computed by PubChem (NCBI)