Products 909282-26-4

CAS 909282-26-4 is the registry number for 2-(2-((Tert-butyldimethylsilyl)oxy)ethoxy)acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid (CAS 909282-26-4) is a chemical compound with the molecular formula C10H22O4Si and a molecular weight of 234.36 g/mol. IUPAC name: 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid. InChIKey: GBHFDUWTIMUQCC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22O4Si
Molecular weight234.36 g/mol
IUPAC name2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]acetic acid
InChIKeyGBHFDUWTIMUQCC-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C)(C)OCCOCC(=O)O

Computed by PubChem (NCBI)