CAS 90947-00-5 appears in our catalog under these names: (E)-5-(4-Iodobenzylidene)-2-thioxothiazolidin-4-one, 95%, NSC 409012, 95%, NSC 409012/ 98.92% (existing batch purity), NSC 409012, NSC409012, 95%, 95%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 25mg, 5mg, 2mg, 10mg, 50mg, 100mg.
(5E)-5-[(4-iodophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 90947-00-5) is a chemical compound with the molecular formula C10H6INOS2 and a molecular weight of 347.2 g/mol. IUPAC name: (5E)-5-[(4-iodophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: LIRUBCDZKKWCPS-VMPITWQZSA-N.
| Molecular formula | C10H6INOS2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | (5E)-5-[(4-iodophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | LIRUBCDZKKWCPS-VMPITWQZSA-N |
| SMILES | C1=CC(=CC=C1/C=C/2\C(=O)NC(=S)S2)I |
Computed by PubChem (NCBI)