Products 909556-32-7
CAS 909556-32-7 is the registry number for Agmatine-d8 (sulfate). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-amino-1,1,2,2,3,3,4,4-octadeuteriobutyl)guanidine;sulfuric acid (CAS 909556-32-7) is a chemical compound with the molecular formula C5H16N4O4S and a molecular weight of 236.32 g/mol. IUPAC name: 2-(4-amino-1,1,2,2,3,3,4,4-octadeuteriobutyl)guanidine;sulfuric acid. InChIKey: PTAYFGHRDOMJGC-PHHTYKMFSA-N.
| Molecular formula | C5H16N4O4S |
|---|---|
| Molecular weight | 236.32 g/mol |
| IUPAC name | 2-(4-amino-1,1,2,2,3,3,4,4-octadeuteriobutyl)guanidine;sulfuric acid |
| InChIKey | PTAYFGHRDOMJGC-PHHTYKMFSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])N=C(N)N)C([2H])([2H])N.OS(=O)(=O)O |
Computed by PubChem (NCBI)