CAS 909711-99-5 is the registry number for Lithium 5-bromopicolinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 5-bromopyridine-2-carboxylate (CAS 909711-99-5) is a chemical compound with the molecular formula C6H3BrLiNO2 and a molecular weight of 208.0 g/mol. IUPAC name: lithium 5-bromopyridine-2-carboxylate. InChIKey: UAZNXOYRNKWYOF-UHFFFAOYSA-M.
| Molecular formula | C6H3BrLiNO2 |
|---|---|
| Molecular weight | 208.0 g/mol |
| IUPAC name | lithium 5-bromopyridine-2-carboxylate |
| InChIKey | UAZNXOYRNKWYOF-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=NC=C1Br)C(=O)[O-] |
Computed by PubChem (NCBI)