CAS 909800-36-8 appears in our catalog under these names: Revefenacin Impurity 5, Revefenacin Impurity 4, Desamino-hydroxy revefenacin, THRX-195518. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
1-[[4-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]carbamoyl]phenyl]methyl]piperidine-4-carboxylic acid (CAS 909800-36-8) is a chemical compound with the molecular formula C35H42N4O5 and a molecular weight of 598.7 g/mol. IUPAC name: 1-[[4-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]carbamoyl]phenyl]methyl]piperidine-4-carboxylic acid. InChIKey: ZVPVPYWMFMUFEZ-UHFFFAOYSA-N.
| Molecular formula | C35H42N4O5 |
|---|---|
| Molecular weight | 598.7 g/mol |
| IUPAC name | 1-[[4-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]carbamoyl]phenyl]methyl]piperidine-4-carboxylic acid |
| InChIKey | ZVPVPYWMFMUFEZ-UHFFFAOYSA-N |
| SMILES | CN(CCN1CCC(CC1)OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)C(=O)C4=CC=C(C=C4)CN5CCC(CC5)C(=O)O |
Computed by PubChem (NCBI)