CAS 90992-25-9 appears in our catalog under these names: Besulpamide, >95% (HPLC), Besulpamide. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 250mg.
(1Z)-4-chloro-3-sulfamoyl-N-(2,4,6-trimethylpyridin-1-ium-1-yl)benzenecarboximidate (CAS 90992-25-9) is a chemical compound with the molecular formula C15H16ClN3O3S and a molecular weight of 353.8 g/mol. IUPAC name: (1Z)-4-chloro-3-sulfamoyl-N-(2,4,6-trimethylpyridin-1-ium-1-yl)benzenecarboximidate. InChIKey: PNDYDXDNOWKEBO-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O3S |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | (1Z)-4-chloro-3-sulfamoyl-N-(2,4,6-trimethylpyridin-1-ium-1-yl)benzenecarboximidate |
| InChIKey | PNDYDXDNOWKEBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=[N+](C(=C1)C)/N=C(/C2=CC(=C(C=C2)Cl)S(=O)(=O)N)\[O-])C |
Computed by PubChem (NCBI)