CAS 910128-59-5 appears in our catalog under these names: 2–(2–Pyridinyldithio)ethyl methacrylate(stabilizedwithMEHQ), 2-(2-Pyridinyldithio)ethyl Methacrylate (stabilized with MEHQ), >98.0%(HPLC), Pyridyl disulfide ethyl methacrylate, 2-(Pyridin-2-yldisulfanyl)ethyl methacrylate 97%, 2-(Pyridin-2-yldisulfanyl)ethyl methacrylate, 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 50mg, 250mg, 1000mg, 500mg, 5g.
2-(pyridin-2-yldisulfanyl)ethyl 2-methylprop-2-enoate (CAS 910128-59-5) is a chemical compound with the molecular formula C11H13NO2S2 and a molecular weight of 255.4 g/mol. IUPAC name: 2-(pyridin-2-yldisulfanyl)ethyl 2-methylprop-2-enoate. InChIKey: SNURDPBGDLYVRE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2S2 |
|---|---|
| Molecular weight | 255.4 g/mol |
| IUPAC name | 2-(pyridin-2-yldisulfanyl)ethyl 2-methylprop-2-enoate |
| InChIKey | SNURDPBGDLYVRE-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCSSC1=CC=CC=N1 |
Computed by PubChem (NCBI)