CAS 910291-20-2 appears in our catalog under these names: 2,7-Diiodo-9,9-bis(trifluoromethyl)-9H-fluorene, 95%, 95%, 2,7-Diiodo-9,9-bis(trifluoromethyl)-9H-fluorene 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,7-diiodo-9,9-bis(trifluoromethyl)fluorene (CAS 910291-20-2) is a chemical compound with the molecular formula C15H6F6I2 and a molecular weight of 554.01 g/mol. IUPAC name: 2,7-diiodo-9,9-bis(trifluoromethyl)fluorene. InChIKey: YTWRREOKQXWAHY-UHFFFAOYSA-N.
| Molecular formula | C15H6F6I2 |
|---|---|
| Molecular weight | 554.01 g/mol |
| IUPAC name | 2,7-diiodo-9,9-bis(trifluoromethyl)fluorene |
| InChIKey | YTWRREOKQXWAHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(C3=C2C=CC(=C3)I)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)