CAS 910387-04-1 is the registry number for ZH8667. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(3-fluorophenyl)phenyl]ethanamine (CAS 910387-04-1) is a chemical compound with the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. IUPAC name: 2-[4-(3-fluorophenyl)phenyl]ethanamine. InChIKey: QQIZQBKKQAFAJV-UHFFFAOYSA-N.
| Molecular formula | C14H14FN |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 2-[4-(3-fluorophenyl)phenyl]ethanamine |
| InChIKey | QQIZQBKKQAFAJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)CCN |
Computed by PubChem (NCBI)