CAS 910484-32-1 appears in our catalog under these names: TTA-Q6(isomer), TTA–Q6(isomer), TTA-Q6 (isomer), TTA-Q6(isomer), 99.84%, 99.84%, TTA-Q6(isomer), 99.91%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 50mg, 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 1mg.
4-[(4R)-6-chloro-4-cyclopropyl-2-oxo-3-(2,2,2-trifluoroethyl)-1H-quinazolin-4-yl]benzonitrile (CAS 910484-32-1) is a chemical compound with the molecular formula C20H15ClF3N3O and a molecular weight of 405.8 g/mol. IUPAC name: 4-[(4R)-6-chloro-4-cyclopropyl-2-oxo-3-(2,2,2-trifluoroethyl)-1H-quinazolin-4-yl]benzonitrile. InChIKey: OVRNWJYZCIAMGV-FQEVSTJZSA-N.
| Molecular formula | C20H15ClF3N3O |
|---|---|
| Molecular weight | 405.8 g/mol |
| IUPAC name | 4-[(4R)-6-chloro-4-cyclopropyl-2-oxo-3-(2,2,2-trifluoroethyl)-1H-quinazolin-4-yl]benzonitrile |
| InChIKey | OVRNWJYZCIAMGV-FQEVSTJZSA-N |
| SMILES | C1CC1[C@]2(C3=C(C=CC(=C3)Cl)NC(=O)N2CC(F)(F)F)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)