Products 91061-36-8
CAS 91061-36-8 appears in our catalog under these names: 2-Methoxy-4,5-dimethylbenzoic acid, 95%, 2-Methoxy-4,5-dimethylbenzoic acid, 98+%, 2–methoxy–4，5–dimethylbenzoic acid, 2-Methoxy-4,5-dimethyl-benzoic acid, 2-Methoxy-4,5-dimethylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 2,5g.
2-methoxy-4,5-dimethylbenzoic acid (CAS 91061-36-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methoxy-4,5-dimethylbenzoic acid. InChIKey: HATRJAVAPAPTBH-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-methoxy-4,5-dimethylbenzoic acid |
| InChIKey | HATRJAVAPAPTBH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)OC)C(=O)O |
Computed by PubChem (NCBI)