CAS 910627-26-8 appears in our catalog under these names: CMX-2043, CMX–2043, N-[5-(3R)-1,2-Dithiolan-3-yl-1-oxopentyl]-L-α-glutamyl-L-alanine, 96%, 96%, CMX-2043, 98.80%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 1mg, 25mg, 10 mg, 5 mg.
(4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-5-oxopentanoic acid (CAS 910627-26-8) is a chemical compound with the molecular formula C16H26N2O6S2 and a molecular weight of 406.5 g/mol. IUPAC name: (4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-5-oxopentanoic acid. InChIKey: MQXRTCVZPIHBLD-TUAOUCFPSA-N.
| Molecular formula | C16H26N2O6S2 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | (4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-5-oxopentanoic acid |
| InChIKey | MQXRTCVZPIHBLD-TUAOUCFPSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CCCC[C@@H]1CCSS1 |
Computed by PubChem (NCBI)