CAS 910647-23-3 is the registry number for Poly((9,9-dihexylfluoren-2,7-diyl)-alt-(2,5-dimethyl-1,4-phenylene)) end capped with dimethylphenyl. Offered by: Lumtec. Available pack sizes: On request.
9-[4-(10-phenylanthracen-9-yl)phenyl]carbazole (CAS 910647-23-3) is a chemical compound with the molecular formula C38H25N and a molecular weight of 495.6 g/mol. IUPAC name: 9-[4-(10-phenylanthracen-9-yl)phenyl]carbazole. InChIKey: UQVFZEYHQJJGPD-UHFFFAOYSA-N.
| Molecular formula | C38H25N |
|---|---|
| Molecular weight | 495.6 g/mol |
| IUPAC name | 9-[4-(10-phenylanthracen-9-yl)phenyl]carbazole |
| InChIKey | UQVFZEYHQJJGPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)