Products 910780-61-9
CAS 910780-61-9 appears in our catalog under these names: ((4-Aminophenyl)imino)dimethyl-lambda6-sulfanone, 95%, ((4-Aminophenyl)imino)dimethyl-lambda6-sulfanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]aniline (CAS 910780-61-9) is a chemical compound with the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. IUPAC name: 4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]aniline. InChIKey: NUJRYDOEXOBYJG-UHFFFAOYSA-N.
| Molecular formula | C8H12N2OS |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | 4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]aniline |
| InChIKey | NUJRYDOEXOBYJG-UHFFFAOYSA-N |
| SMILES | CS(=NC1=CC=C(C=C1)N)(=O)C |
Computed by PubChem (NCBI)