Products 911132-57-5
CAS 911132-57-5 appears in our catalog under these names: 3-Aminobenzoic-d4 Acid Methyl Ester, Methyl 3-Aminobenzoate-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, 3–Aminobenzoic–d4 Acid Methyl Ester, Methyl 3-aminobenzoate-d4. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 10 mg, 100 mg.
Methyl 3-amino-2,4,5,6-tetradeuteriobenzoate (CAS 911132-57-5) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 155.19 g/mol. IUPAC name: methyl 3-amino-2,4,5,6-tetradeuteriobenzoate. InChIKey: VZDNXXPBYLGWOS-QFFDRWTDSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | methyl 3-amino-2,4,5,6-tetradeuteriobenzoate |
| InChIKey | VZDNXXPBYLGWOS-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)[2H])C(=O)OC)[2H] |
Computed by PubChem (NCBI)