CAS 911372-78-6 appears in our catalog under these names: (R)-4-(1-Aminoethyl)benzonitrile hydrochloride, 95%, (R)-4-(1-Aminoethyl)benzonitrile hydrochloride ee, (R)-4-(1-Aminoethyl)benzonitrile hydrochloride 97%, (R)-4-(1-Aminoethyl)benzonitrile hydrochloride, 97%, 97%, (R)-4-(1-Aminoethyl)benzonitrile hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
4-[(1R)-1-aminoethyl]benzonitrile;hydrochloride (CAS 911372-78-6) is a chemical compound with the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]benzonitrile;hydrochloride. InChIKey: KZLPYAMQKGFHBF-OGFXRTJISA-N.
| Molecular formula | C9H11ClN2 |
|---|---|
| Molecular weight | 182.65 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]benzonitrile;hydrochloride |
| InChIKey | KZLPYAMQKGFHBF-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C#N)N.Cl |
Computed by PubChem (NCBI)