Products 911417-62-4

CAS 911417-62-4 is the registry number for 2-[3-[4-(1H-Indazol-5-ylamino)-2-quinazolinyl]phenoxy]acetic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetic acid (CAS 911417-62-4) is a chemical compound with the molecular formula C23H17N5O3 and a molecular weight of 411.4 g/mol. IUPAC name: 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetic acid. InChIKey: UHUDLFMBGUWKOR-UHFFFAOYSA-N.

Identity
Molecular formulaC23H17N5O3
Molecular weight411.4 g/mol
IUPAC name2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetic acid
InChIKeyUHUDLFMBGUWKOR-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NC(=N2)C3=CC(=CC=C3)OCC(=O)O)NC4=CC5=C(C=C4)NN=C5

Computed by PubChem (NCBI)