CAS 911417-87-3 appears in our catalog under these names: KD 025, SLx–2119, Belumosudil/ 98.37% (existing batch purity), SLX-2119, Belumosudil 99%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 2mg, 50mg, 500mg.
2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]-N-propan-2-ylacetamide (CAS 911417-87-3) is a chemical compound with the molecular formula C26H24N6O2 and a molecular weight of 452.5 g/mol. IUPAC name: 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]-N-propan-2-ylacetamide. InChIKey: GKHIVNAUVKXIIY-UHFFFAOYSA-N.
| Molecular formula | C26H24N6O2 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]-N-propan-2-ylacetamide |
| InChIKey | GKHIVNAUVKXIIY-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)COC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=N2)NC4=CC5=C(C=C4)NN=C5 |
Computed by PubChem (NCBI)