CAS 911417-89-5 is the registry number for Desisopropyle-belumosudil. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide (CAS 911417-89-5) is a chemical compound with the molecular formula C23H18N6O2 and a molecular weight of 410.4 g/mol. IUPAC name: 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide. InChIKey: LCCUVYBNWKCWDG-UHFFFAOYSA-N.
| Molecular formula | C23H18N6O2 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 2-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide |
| InChIKey | LCCUVYBNWKCWDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC(=CC=C3)OCC(=O)N)NC4=CC5=C(C=C4)NN=C5 |
Computed by PubChem (NCBI)