CAS 911419-33-5 is the registry number for Belumosudil Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] acetate (CAS 911419-33-5) is a chemical compound with the molecular formula C23H17N5O2 and a molecular weight of 395.4 g/mol. IUPAC name: [3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] acetate. InChIKey: XJIPWWGXFAAPFY-UHFFFAOYSA-N.
| Molecular formula | C23H17N5O2 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | [3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] acetate |
| InChIKey | XJIPWWGXFAAPFY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=N2)NC4=CC5=C(C=C4)NN=C5 |
Computed by PubChem (NCBI)