Products 911430-74-5
CAS 911430-74-5 is the registry number for 5'–O–Trt–dI. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 911430-74-5) is a chemical compound with the molecular formula C29H26N4O4 and a molecular weight of 494.5 g/mol. IUPAC name: 9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: IIUOCTOEVNXRTP-ISJGIBHGSA-N.
| Molecular formula | C29H26N4O4 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | 9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | IIUOCTOEVNXRTP-ISJGIBHGSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=CNC3=O)COC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)O |
Computed by PubChem (NCBI)