CAS 91158-65-5 is the registry number for Acetic acid, cyano[[[(4-methylphenyl)sulfonyl]oxy]amino]-, ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
Ethyl 2-cyano-2-[(4-methylphenyl)sulfonyloxyamino]acetate (CAS 91158-65-5) is a chemical compound with the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. IUPAC name: ethyl 2-cyano-2-[(4-methylphenyl)sulfonyloxyamino]acetate. InChIKey: QRZXTKMAOUDRDU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5S |
|---|---|
| Molecular weight | 298.32 g/mol |
| IUPAC name | ethyl 2-cyano-2-[(4-methylphenyl)sulfonyloxyamino]acetate |
| InChIKey | QRZXTKMAOUDRDU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)NOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)