CAS 91159-79-4 appears in our catalog under these names: 4-Azidoaniline Hydrochloride, 4–Azidoaniline hydrochloride, 4-AZIDOANILINEHYDROCHLORIDE,97%, 4-Azidoaniline (hydrochloride), 4-AZIDOANILINE HYDROCHLORIDE, 97%. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 2,5g, 1g, 250mg, 100mg, 500mg, 1000mg, Get quote.
4-azidoaniline;hydrochloride (CAS 91159-79-4) is a chemical compound with the molecular formula C6H7ClN4 and a molecular weight of 170.60 g/mol. IUPAC name: 4-azidoaniline;hydrochloride. InChIKey: SDYAJRBHPPWHSF-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN4 |
|---|---|
| Molecular weight | 170.60 g/mol |
| IUPAC name | 4-azidoaniline;hydrochloride |
| InChIKey | SDYAJRBHPPWHSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)