Products 911678-16-5

CAS 911678-16-5 is the registry number for 2-(N,N-Dimethyl-N-propargylammonium)-1-bromoethane Bromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

2-bromoethyl-dimethyl-prop-2-ynylazanium bromide (CAS 911678-16-5) is a chemical compound with the molecular formula C7H13Br2N and a molecular weight of 270.99 g/mol. IUPAC name: 2-bromoethyl-dimethyl-prop-2-ynylazanium bromide. InChIKey: XCVHBSJVDXVDPH-UHFFFAOYSA-M.

Identity
Molecular formulaC7H13Br2N
Molecular weight270.99 g/mol
IUPAC name2-bromoethyl-dimethyl-prop-2-ynylazanium bromide
InChIKeyXCVHBSJVDXVDPH-UHFFFAOYSA-M
SMILESC[N+](C)(CCBr)CC#C.[Br-]

Computed by PubChem (NCBI)