Products 911689-85-5
CAS 911689-85-5 is the registry number for (R)-1-methoxy-1-oxopropan-2-yl (R)-2-hydroxypropanoate. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-1-methoxy-1-oxopropan-2-yl] (2R)-2-hydroxypropanoate (CAS 911689-85-5) is a chemical compound with the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. IUPAC name: [(2R)-1-methoxy-1-oxopropan-2-yl] (2R)-2-hydroxypropanoate. InChIKey: LMQQAQDHUZSAQC-RFZPGFLSSA-N.
| Molecular formula | C7H12O5 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | [(2R)-1-methoxy-1-oxopropan-2-yl] (2R)-2-hydroxypropanoate |
| InChIKey | LMQQAQDHUZSAQC-RFZPGFLSSA-N |
| SMILES | C[C@H](C(=O)O[C@H](C)C(=O)OC)O |
Computed by PubChem (NCBI)