Products 91171-33-4

CAS 91171-33-4 is the registry number for Phenylbis(m-sulfophenyl)phosphine. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid (CAS 91171-33-4) is a chemical compound with the molecular formula C18H15O6PS2 and a molecular weight of 422.4 g/mol. IUPAC name: 3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid. InChIKey: VHQVWVBUIMMANM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15O6PS2
Molecular weight422.4 g/mol
IUPAC name3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid
InChIKeyVHQVWVBUIMMANM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)P(C2=CC(=CC=C2)S(=O)(=O)O)C3=CC(=CC=C3)S(=O)(=O)O

Computed by PubChem (NCBI)