CAS 91171-33-4 is the registry number for Phenylbis(m-sulfophenyl)phosphine. Offered by: Chemat Brand. Available pack sizes: on request.
3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid (CAS 91171-33-4) is a chemical compound with the molecular formula C18H15O6PS2 and a molecular weight of 422.4 g/mol. IUPAC name: 3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid. InChIKey: VHQVWVBUIMMANM-UHFFFAOYSA-N.
| Molecular formula | C18H15O6PS2 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | 3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid |
| InChIKey | VHQVWVBUIMMANM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC(=CC=C2)S(=O)(=O)O)C3=CC(=CC=C3)S(=O)(=O)O |
Computed by PubChem (NCBI)