CAS 91180-82-4 appears in our catalog under these names: 1,3,3-Trimethyl-1,2,3,4-tetrahydroquinoxalin-2-one, 95%, 1,3,3-Trimethyl-1,2,3,4-tetrahydroquinoxalin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,3,3-trimethyl-4H-quinoxalin-2-one (CAS 91180-82-4) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 1,3,3-trimethyl-4H-quinoxalin-2-one. InChIKey: NJNXNAWEVLDAOW-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1,3,3-trimethyl-4H-quinoxalin-2-one |
| InChIKey | NJNXNAWEVLDAOW-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C2=CC=CC=C2N1)C)C |
Computed by PubChem (NCBI)