CAS 91182-70-6 appears in our catalog under these names: Ethyl 5,7-dibromo-1-benzofuran-2-carboxylate, 95%, Ethyl 5,7-dibromobenzofuran-2-carboxylate, 97%, Ethyl 5,7–dibromobenzofuran–2–carboxylate, ethyl 5,7-dibromobenzofuran-2-carboxylate, 97%, 97%, Ethyl 5,7-dibromobenzofuran-2-carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Ethyl 5,7-dibromo-1-benzofuran-2-carboxylate (CAS 91182-70-6) is a chemical compound with the molecular formula C11H8Br2O3 and a molecular weight of 347.99 g/mol. IUPAC name: ethyl 5,7-dibromo-1-benzofuran-2-carboxylate. InChIKey: ILHAZUKNVMSAQE-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2O3 |
|---|---|
| Molecular weight | 347.99 g/mol |
| IUPAC name | ethyl 5,7-dibromo-1-benzofuran-2-carboxylate |
| InChIKey | ILHAZUKNVMSAQE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2O1)Br)Br |
Computed by PubChem (NCBI)