CAS 911826-11-4 is the registry number for (R)-7-Fluorochroman-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine (CAS 911826-11-4) is a chemical compound with the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. IUPAC name: (4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine. InChIKey: UMQCCSDLCJERPE-MRVPVSSYSA-N.
| Molecular formula | C9H10FNO |
|---|---|
| Molecular weight | 167.18 g/mol |
| IUPAC name | (4R)-7-fluoro-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | UMQCCSDLCJERPE-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC(=C2)F |
Computed by PubChem (NCBI)