CAS 91183-71-0 appears in our catalog under these names: H–Met–OtBu·HCl, L-Methionine tert-butyl ester hydrochloride, H-Met-OtBu·HCl 97%, L-Methionine tert-butyl ester hydrochloride, 97%, 97%, H-Met-OtBu.HCl, 99.69%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 2g, 10g, 25g, 50g, 250mg, 1g, 1 g.
Tert-butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CAS 91183-71-0) is a chemical compound with the molecular formula C9H20ClNO2S and a molecular weight of 241.78 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride. InChIKey: KZJQROCWHZGZBJ-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2S |
|---|---|
| Molecular weight | 241.78 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| InChIKey | KZJQROCWHZGZBJ-FJXQXJEOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCSC)N.Cl |
Computed by PubChem (NCBI)