CAS 91190-73-7 appears in our catalog under these names: 2-(Hydroxymethyl)-N,N-dimethylbenzene-1-sulfonamide, 95%, 2-(Hydroxymethyl)-N,N-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(hydroxymethyl)-N,N-dimethylbenzenesulfonamide (CAS 91190-73-7) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: 2-(hydroxymethyl)-N,N-dimethylbenzenesulfonamide. InChIKey: KBDKCOUCORRGTM-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 2-(hydroxymethyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | KBDKCOUCORRGTM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1CO |
Computed by PubChem (NCBI)