CAS 912368-67-3 is the registry number for Potassium (Z)–3–cyano–3–(thiophen–2–yl)acrylate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Potassium (Z)-3-cyano-3-thiophen-2-ylprop-2-enoate (CAS 912368-67-3) is a chemical compound with the molecular formula C8H4KNO2S and a molecular weight of 217.29 g/mol. IUPAC name: potassium (Z)-3-cyano-3-thiophen-2-ylprop-2-enoate. InChIKey: BBQSCGRDQRRBAX-YHSAGPEESA-M.
| Molecular formula | C8H4KNO2S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | potassium (Z)-3-cyano-3-thiophen-2-ylprop-2-enoate |
| InChIKey | BBQSCGRDQRRBAX-YHSAGPEESA-M |
| SMILES | C1=CSC(=C1)/C(=C\C(=O)[O-])/C#N.[K+] |
Computed by PubChem (NCBI)