CAS 91245-82-8 is the registry number for 1-{4-((Dimethylamino)methyl)phenyl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[4-[(dimethylamino)methyl]phenyl]ethanone (CAS 91245-82-8) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 1-[4-[(dimethylamino)methyl]phenyl]ethanone. InChIKey: QVUOUGMOYJKOPL-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 1-[4-[(dimethylamino)methyl]phenyl]ethanone |
| InChIKey | QVUOUGMOYJKOPL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)CN(C)C |
Computed by PubChem (NCBI)