Products 912627-98-6
CAS 912627-98-6 appears in our catalog under these names: 2-Phenyl-d5-ethyl Isothiocyanate, 98 atom % D, min 98% Chemical Purity, 2–Phenylethyl isothiocyanate–d5, 2-Phenylethyl isothiocyanate-d5, 94.40%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 5 mg, 10 mg.
1,2,3,4,5-pentadeuterio-6-(2-isothiocyanatoethyl)benzene (CAS 912627-98-6) is a chemical compound with the molecular formula C9H9NS and a molecular weight of 168.27 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2-isothiocyanatoethyl)benzene. InChIKey: IZJDOKYDEWTZSO-RALIUCGRSA-N.
| Molecular formula | C9H9NS |
|---|---|
| Molecular weight | 168.27 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2-isothiocyanatoethyl)benzene |
| InChIKey | IZJDOKYDEWTZSO-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCN=C=S)[2H])[2H] |
Computed by PubChem (NCBI)