Products 912770-84-4
CAS 912770-84-4 is the registry number for N-(1-Cyanocyclohexyl)-3-fluorobenzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1-cyanocyclohexyl)-3-fluorobenzamide (CAS 912770-84-4) is a chemical compound with the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. IUPAC name: N-(1-cyanocyclohexyl)-3-fluorobenzamide. InChIKey: RGRFDMQJKTUTKF-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | N-(1-cyanocyclohexyl)-3-fluorobenzamide |
| InChIKey | RGRFDMQJKTUTKF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)NC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)