Products 912784-61-3
CAS 912784-61-3 is the registry number for 5-(4-Fluorophenyl)-N-(pyridin-3-ylmethyl)isoxazole-3-carboxamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg.
5-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide (CAS 912784-61-3) is a chemical compound with the molecular formula C16H12FN3O2 and a molecular weight of 297.28 g/mol. IUPAC name: 5-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide. InChIKey: LVPIQIMXXAPFFU-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O2 |
|---|---|
| Molecular weight | 297.28 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide |
| InChIKey | LVPIQIMXXAPFFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=O)C2=NOC(=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)