CAS 912838-37-0 is the registry number for 4-Azido-n-(3-phenyl-propyl)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-azido-N-(3-phenylpropyl)benzamide (CAS 912838-37-0) is a chemical compound with the molecular formula C16H16N4O and a molecular weight of 280.32 g/mol. IUPAC name: 4-azido-N-(3-phenylpropyl)benzamide. InChIKey: OAXKMAACTYRQRP-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 4-azido-N-(3-phenylpropyl)benzamide |
| InChIKey | OAXKMAACTYRQRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCNC(=O)C2=CC=C(C=C2)N=[N+]=[N-] |
Computed by PubChem (NCBI)