CAS 912839-06-6 is the registry number for 1-4-[(Ethylamino)carbonyl]phenyl-5-isopropyl-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[4-(ethylcarbamoyl)phenyl]-5-propan-2-yltriazole-4-carboxylic acid (CAS 912839-06-6) is a chemical compound with the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. IUPAC name: 1-[4-(ethylcarbamoyl)phenyl]-5-propan-2-yltriazole-4-carboxylic acid. InChIKey: GLLDSAHXIQJDDL-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O3 |
|---|---|
| Molecular weight | 302.33 g/mol |
| IUPAC name | 1-[4-(ethylcarbamoyl)phenyl]-5-propan-2-yltriazole-4-carboxylic acid |
| InChIKey | GLLDSAHXIQJDDL-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC=C(C=C1)N2C(=C(N=N2)C(=O)O)C(C)C |
Computed by PubChem (NCBI)