Products 912906-94-6
CAS 912906-94-6 appears in our catalog under these names: 5-(Chloromethyl)-1-(4-fluorophenyl)-1h-tetrazole, 95%, 5-(chloromethyl)-1-(4-fluorophenyl)-1h-tetrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
5-(chloromethyl)-1-(4-fluorophenyl)tetrazole (CAS 912906-94-6) is a chemical compound with the molecular formula C8H6ClFN4 and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-1-(4-fluorophenyl)tetrazole. InChIKey: FIGNQIBUPZMKSM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN4 |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-1-(4-fluorophenyl)tetrazole |
| InChIKey | FIGNQIBUPZMKSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=NN=N2)CCl)F |
Computed by PubChem (NCBI)