Products 912921-27-8
CAS 912921-27-8 appears in our catalog under these names: 6-Azido-2-ethyl-1H-benzo(de)isoquinoline-1,3(2H)-dione, 95-<97%, 4–azido–N–ethyl–1,8–naphthalimide. Offered by: Hoffman Fine Chemicals, GLPBio. Available pack sizes: 2,5g, 5g, 10g, 10mg.
6-azido-2-ethylbenzo[de]isoquinoline-1,3-dione (CAS 912921-27-8) is a chemical compound with the molecular formula C14H10N4O2 and a molecular weight of 266.25 g/mol. IUPAC name: 6-azido-2-ethylbenzo[de]isoquinoline-1,3-dione. InChIKey: PLRPPRRYIDIPID-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O2 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 6-azido-2-ethylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | PLRPPRRYIDIPID-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C3C(=C(C=C2)N=[N+]=[N-])C=CC=C3C1=O |
Computed by PubChem (NCBI)