CAS 913089-08-4 is the registry number for Carbamic acid (R)-1-(2-chlorophenyl)-2-(1H-tetrazol-1-yl)ethyl ester. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
[(1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethyl] carbamate (CAS 913089-08-4) is a chemical compound with the molecular formula C10H10ClN5O2 and a molecular weight of 267.67 g/mol. IUPAC name: [(1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethyl] carbamate. InChIKey: FZOAULIRKNUTJY-VIFPVBQESA-N.
| Molecular formula | C10H10ClN5O2 |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | [(1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethyl] carbamate |
| InChIKey | FZOAULIRKNUTJY-VIFPVBQESA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CN2C=NN=N2)OC(=O)N)Cl |
Computed by PubChem (NCBI)