CAS 91312-70-8 appears in our catalog under these names: Cyclohexylmethyltriphenylphosphonium iodide, 97%, (Cyclohexylmethyl)triphenylphosphonium iodide 97%, Cyclohexylmethyltriphenylphosphonium iodide, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Cyclohexylmethyl(triphenyl)phosphanium iodide (CAS 91312-70-8) is a chemical compound with the molecular formula C25H28IP and a molecular weight of 486.4 g/mol. IUPAC name: cyclohexylmethyl(triphenyl)phosphanium iodide. InChIKey: WTXJJRORCSDLEF-UHFFFAOYSA-M.
| Molecular formula | C25H28IP |
|---|---|
| Molecular weight | 486.4 g/mol |
| IUPAC name | cyclohexylmethyl(triphenyl)phosphanium iodide |
| InChIKey | WTXJJRORCSDLEF-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[I-] |
Computed by PubChem (NCBI)