CAS 91313-55-2 appears in our catalog under these names: Potassium phloroglucinol carboxylate, 95%, Potassium 2,4,6-trihydroxybenzoate, 98%, Potassium phloroglucinol carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
Potassium 2,4,6-trihydroxybenzoate (CAS 91313-55-2) is a chemical compound with the molecular formula C7H5KO5 and a molecular weight of 208.21 g/mol. IUPAC name: potassium 2,4,6-trihydroxybenzoate. InChIKey: LXBILIBIMQVTQT-UHFFFAOYSA-M.
| Molecular formula | C7H5KO5 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | potassium 2,4,6-trihydroxybenzoate |
| InChIKey | LXBILIBIMQVTQT-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1O)C(=O)[O-])O)O.[K+] |
Computed by PubChem (NCBI)