Products 91315-34-3

CAS 91315-34-3 is the registry number for Centpropazine, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

1-[4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]phenyl]propan-1-one (CAS 91315-34-3) is a chemical compound with the molecular formula C22H28N2O3 and a molecular weight of 368.5 g/mol. IUPAC name: 1-[4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]phenyl]propan-1-one. InChIKey: ZQPXSRTZFYHSFB-UHFFFAOYSA-N.

Identity
Molecular formulaC22H28N2O3
Molecular weight368.5 g/mol
IUPAC name1-[4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]phenyl]propan-1-one
InChIKeyZQPXSRTZFYHSFB-UHFFFAOYSA-N
SMILESCCC(=O)C1=CC=C(C=C1)OCC(CN2CCN(CC2)C3=CC=CC=C3)O

Computed by PubChem (NCBI)