CAS 913196-44-8 is the registry number for (S)-1-(2-(Diphenylphosphanyl)phenyl)-N-methylethan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2-diphenylphosphanylphenyl)-N-methylethanamine (CAS 913196-44-8) is a chemical compound with the molecular formula C21H22NP and a molecular weight of 319.4 g/mol. IUPAC name: (1S)-1-(2-diphenylphosphanylphenyl)-N-methylethanamine. InChIKey: FDKXFWNTWXDTPN-KRWDZBQOSA-N.
| Molecular formula | C21H22NP |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (1S)-1-(2-diphenylphosphanylphenyl)-N-methylethanamine |
| InChIKey | FDKXFWNTWXDTPN-KRWDZBQOSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)NC |
Computed by PubChem (NCBI)