CAS 913198-23-9 is the registry number for (4–((4–(Trifluoromethoxy)phenyl)carbamoyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]boronic acid (CAS 913198-23-9) is a chemical compound with the molecular formula C14H11BF3NO4 and a molecular weight of 325.05 g/mol. IUPAC name: [4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]boronic acid. InChIKey: WDFVWQJPYTYGOT-UHFFFAOYSA-N.
| Molecular formula | C14H11BF3NO4 |
|---|---|
| Molecular weight | 325.05 g/mol |
| IUPAC name | [4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]boronic acid |
| InChIKey | WDFVWQJPYTYGOT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)