CAS 913258-31-8 appears in our catalog under these names: Latanoprost EP Impurity G (Latanoprost Methyl Ester), Latanoprost Methyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
Methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (CAS 913258-31-8) is a chemical compound with the molecular formula C24H36O5 and a molecular weight of 404.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate. InChIKey: KSRNMZVGEYUNEO-JNAAKWLTSA-N.
| Molecular formula | C24H36O5 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| InChIKey | KSRNMZVGEYUNEO-JNAAKWLTSA-N |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CC[C@H](CCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)