CAS 913263-04-4 is the registry number for Difluoro(trimethylsilyl)methylphosphonic Acid. Offered by: TRC. Available pack sizes: 100mg.
[difluoro(trimethylsilyl)methyl]phosphonic acid (CAS 913263-04-4) is a chemical compound with the molecular formula C4H11F2O3PSi and a molecular weight of 204.18 g/mol. IUPAC name: [difluoro(trimethylsilyl)methyl]phosphonic acid. InChIKey: AQNQDNPBGPSXLA-UHFFFAOYSA-N.
| Molecular formula | C4H11F2O3PSi |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | [difluoro(trimethylsilyl)methyl]phosphonic acid |
| InChIKey | AQNQDNPBGPSXLA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(F)(F)P(=O)(O)O |
Computed by PubChem (NCBI)