Products 913297-04-8

CAS 913297-04-8 is the registry number for 2-(2-Chlorophenyl)morpholine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)morpholine;oxalic acid (CAS 913297-04-8) is a chemical compound with the molecular formula C12H14ClNO5 and a molecular weight of 287.69 g/mol. IUPAC name: 2-(2-chlorophenyl)morpholine;oxalic acid. InChIKey: DVKWCLUMELMKMI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO5
Molecular weight287.69 g/mol
IUPAC name2-(2-chlorophenyl)morpholine;oxalic acid
InChIKeyDVKWCLUMELMKMI-UHFFFAOYSA-N
SMILESC1COC(CN1)C2=CC=CC=C2Cl.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)