CAS 913388-54-2 appears in our catalog under these names: 1H-Indole-1-carboxylic acid, 2-borono-5-formyl-, 1-(1,1-dimethylethyl) ester, 95%, (1-(tert-Butoxycarbonyl)-5-formyl-1H-indol-2-yl)boronic acid, 99%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
[5-formyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 913388-54-2) is a chemical compound with the molecular formula C14H16BNO5 and a molecular weight of 289.09 g/mol. IUPAC name: [5-formyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: RNWAFVRASZKNCT-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO5 |
|---|---|
| Molecular weight | 289.09 g/mol |
| IUPAC name | [5-formyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | RNWAFVRASZKNCT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C=O)(O)O |
Computed by PubChem (NCBI)